C8H10Cl3NO — CID 101149800
2,2,2-trichloro-N-[[(1S)-cyclopent-2-en-1-yl]methyl]acetamide (PubChem CID 101149800) has the molecular formula C8H10Cl3NO and a molecular weight of 242.53 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[(1S)-cyclopent-2-en-1-yl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[(1S)-cyclopent-2-en-1-yl]methyl]acetamide |
|---|---|
| PubChem CID | 101149800 |
| Molecular Formula | C8H10Cl3NO |
| Molecular Weight | 242.53 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 2,2,2-trichloro-N-[[(1S)-cyclopent-2-en-1-yl]methyl]acetamide |
| SMILES | O=C(NC[C@@H]1C=CCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10Cl3NO/c9-8(10,11)7(13)12-5-6-3-1-2-4-6/h1,3,6H,2,4-5H2,(H,12,13)/t6-/m1/s1 |
| InChIKey | UQCDRSJAKQDBJU-ZCFIWIBFSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|