C7H11NO — CID 51382690
2-[(1R)-cyclopent-2-en-1-yl]acetamide (PubChem CID 51382690) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]acetamide.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 51382690 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1C=CCC1 |
| InChI | InChI=1S/C7H11NO/c8-7(9)5-6-3-1-2-4-6/h1,3,6H,2,4-5H2,(H2,8,9)/t6-/m1/s1 |
| InChIKey | XAXWNGSRJOPLSP-ZCFIWIBFSA-N |
| XLogP | 0.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|