C18H33NO — CID 141290555
13-[(1R)-cyclopent-2-en-1-yl]tridecanamide (PubChem CID 141290555) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 13-[(1R)-cyclopent-2-en-1-yl]tridecanamide.
| Compound Name | 13-[(1R)-cyclopent-2-en-1-yl]tridecanamide |
|---|---|
| PubChem CID | 141290555 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 13-[(1R)-cyclopent-2-en-1-yl]tridecanamide |
| SMILES | NC(=O)CCCCCCCCCCCC[C@H]1C=CCC1 |
| InChI | InChI=1S/C18H33NO/c19-18(20)16-10-8-6-4-2-1-3-5-7-9-13-17-14-11-12-15-17/h11,14,17H,1-10,12-13,15-16H2,(H2,19,20)/t17-/m0/s1 |
| InChIKey | WCORVKWHDVHVCP-KRWDZBQOSA-N |
| XLogP | 5.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|