C36H52O4 — CID 90014146
13-cyclopent-2-en-1-yltridecanoic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol (PubChem CID 90014146) has the molecular formula C36H52O4 and a molecular weight of 548.81 g/mol. Its IUPAC name is 13-cyclopent-2-en-1-yltridecanoic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol.
| Compound Name | 13-cyclopent-2-en-1-yltridecanoic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
|---|---|
| PubChem CID | 90014146 |
| Molecular Formula | C36H52O4 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | 13-cyclopent-2-en-1-yltridecanoic acid;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
| SMILES | CC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1.O=C(O)CCCCCCCCCCCCC1C=CCC1 |
| InChI | InChI=1S/C18H20O2.C18H32O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14;19-18(20)16-10-8-6-4-2-1-3-5-7-9-13-17-14-11-12-15-17/h5-12,19-20H,3-4H2,1-2H3;11,14,17H,1-10,12-13,15-16H2,(H,19,20)/b18-17+; |
| InChIKey | ZEUQEPWBDIBLLR-ZAGWXBKKSA-N |
| XLogP | 10.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|