C25H46NO+ — CID 58163576
[(E)-17-[(1R)-cyclopent-2-en-1-yl]-5-oxoheptadec-10-enyl]-trimethylazanium (PubChem CID 58163576) has the molecular formula C25H46NO+ and a molecular weight of 376.65 g/mol. Its IUPAC name is [(E)-17-[(1R)-cyclopent-2-en-1-yl]-5-oxoheptadec-10-enyl]-trimethylazanium.
| Compound Name | [(E)-17-[(1R)-cyclopent-2-en-1-yl]-5-oxoheptadec-10-enyl]-trimethylazanium |
|---|---|
| PubChem CID | 58163576 |
| Molecular Formula | C25H46NO+ |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.36 |
| IUPAC Name | [(E)-17-[(1R)-cyclopent-2-en-1-yl]-5-oxoheptadec-10-enyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CCCCC(=O)CCCC/C=C/CCCCCC[C@H]1C=CCC1 |
| InChI | InChI=1S/C25H46NO/c1-26(2,3)23-17-16-22-25(27)21-13-11-9-7-5-4-6-8-10-12-18-24-19-14-15-20-24/h5,7,14,19,24H,4,6,8-13,15-18,20-23H2,1-3H3/q+1/b7-5+/t24-/m0/s1 |
| InChIKey | DMWNQEPBUAXIRL-COIATFDQSA-N |
| XLogP | 6.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|