C12H19NOS — CID 97068704
2-[(1R)-cyclopent-2-en-1-yl]-N-[[(2R)-thiolan-2-yl]methyl]acetamide (PubChem CID 97068704) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-N-[[(2R)-thiolan-2-yl]methyl]acetamide.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[[(2R)-thiolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97068704 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[[(2R)-thiolan-2-yl]methyl]acetamide |
| SMILES | O=C(C[C@@H]1C=CCC1)NC[C@H]1CCCS1 |
| InChI | InChI=1S/C12H19NOS/c14-12(8-10-4-1-2-5-10)13-9-11-6-3-7-15-11/h1,4,10-11H,2-3,5-9H2,(H,13,14)/t10-,11-/m1/s1 |
| InChIKey | KLRJGAWAKTXEJR-GHMZBOCLSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|