C9H17N3O2S — CID 80584787
2-amino-N-[2-oxo-2-(thiolan-2-ylmethylamino)ethyl]acetamide (PubChem CID 80584787) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-(thiolan-2-ylmethylamino)ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-(thiolan-2-ylmethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 80584787 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-amino-N-[2-oxo-2-(thiolan-2-ylmethylamino)ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCC1CCCS1 |
| InChI | InChI=1S/C9H17N3O2S/c10-4-8(13)12-6-9(14)11-5-7-2-1-3-15-7/h7H,1-6,10H2,(H,11,14)(H,12,13) |
| InChIKey | JZZLJXMKDFQVFG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |