C15H27NO2 — CID 111444858
2-cyclopent-2-en-1-yl-N-(2-hydroxy-2-propylpentyl)acetamide (PubChem CID 111444858) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(2-hydroxy-2-propylpentyl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(2-hydroxy-2-propylpentyl)acetamide |
|---|---|
| PubChem CID | 111444858 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(2-hydroxy-2-propylpentyl)acetamide |
| SMILES | CCCC(O)(CCC)CNC(=O)CC1C=CCC1 |
| InChI | InChI=1S/C15H27NO2/c1-3-9-15(18,10-4-2)12-16-14(17)11-13-7-5-6-8-13/h5,7,13,18H,3-4,6,8-12H2,1-2H3,(H,16,17) |
| InChIKey | BOGRKNUBKTVSRK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|