C15H28N2O2 — CID 111438902
1-cyclohex-3-en-1-yl-3-(2-hydroxy-2-propylpentyl)urea (PubChem CID 111438902) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-3-(2-hydroxy-2-propylpentyl)urea.
| Compound Name | 1-cyclohex-3-en-1-yl-3-(2-hydroxy-2-propylpentyl)urea |
|---|---|
| PubChem CID | 111438902 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-3-(2-hydroxy-2-propylpentyl)urea |
| SMILES | CCCC(O)(CCC)CNC(=O)NC1CC=CCC1 |
| InChI | InChI=1S/C15H28N2O2/c1-3-10-15(19,11-4-2)12-16-14(18)17-13-8-6-5-7-9-13/h5-6,13,19H,3-4,7-12H2,1-2H3,(H2,16,17,18) |
| InChIKey | VQZJEOJAUPYXTR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|