C13H23NO2 — CID 65113826
2-cyclopent-2-en-1-yl-N-(2-ethyl-2-hydroxybutyl)acetamide (PubChem CID 65113826) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(2-ethyl-2-hydroxybutyl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(2-ethyl-2-hydroxybutyl)acetamide |
|---|---|
| PubChem CID | 65113826 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(2-ethyl-2-hydroxybutyl)acetamide |
| SMILES | CCC(O)(CC)CNC(=O)CC1C=CCC1 |
| InChI | InChI=1S/C13H23NO2/c1-3-13(16,4-2)10-14-12(15)9-11-7-5-6-8-11/h5,7,11,16H,3-4,6,8-10H2,1-2H3,(H,14,15) |
| InChIKey | AJNGRXCSJMNKAA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|