C10H21ClN2O2S — CID 119790691
2-(2-methoxyethylamino)-N-(thiolan-2-ylmethyl)acetamide;hydrochloride (PubChem CID 119790691) has the molecular formula C10H21ClN2O2S and a molecular weight of 268.81 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(thiolan-2-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(thiolan-2-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119790691 |
| Molecular Formula | C10H21ClN2O2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(thiolan-2-ylmethyl)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCC1CCCS1.Cl |
| InChI | InChI=1S/C10H20N2O2S.ClH/c1-14-5-4-11-8-10(13)12-7-9-3-2-6-15-9;/h9,11H,2-8H2,1H3,(H,12,13);1H |
| InChIKey | NRURWBXORIQKFW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|