C10H21ClN2O3 — CID 119670121
2-(2-methoxyethylamino)-N-(oxolan-2-ylmethyl)acetamide;hydrochloride (PubChem CID 119670121) has the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(oxolan-2-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(oxolan-2-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119670121 |
| Molecular Formula | C10H21ClN2O3 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(oxolan-2-ylmethyl)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCC1CCCO1.Cl |
| InChI | InChI=1S/C10H20N2O3.ClH/c1-14-6-4-11-8-10(13)12-7-9-3-2-5-15-9;/h9,11H,2-8H2,1H3,(H,12,13);1H |
| InChIKey | LJERHMPVCWBWJJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|