C14H24N2O7 — CID 175652932
oxalic acid;N-(oxolan-2-ylmethyl)-2-(oxolan-2-ylmethylamino)acetamide (PubChem CID 175652932) has the molecular formula C14H24N2O7 and a molecular weight of 332.35 g/mol. Its IUPAC name is oxalic acid;N-(oxolan-2-ylmethyl)-2-(oxolan-2-ylmethylamino)acetamide.
| Compound Name | oxalic acid;N-(oxolan-2-ylmethyl)-2-(oxolan-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 175652932 |
| Molecular Formula | C14H24N2O7 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | oxalic acid;N-(oxolan-2-ylmethyl)-2-(oxolan-2-ylmethylamino)acetamide |
| SMILES | O=C(CNCC1CCCO1)NCC1CCCO1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H22N2O3.C2H2O4/c15-12(14-8-11-4-2-6-17-11)9-13-7-10-3-1-5-16-10;3-1(4)2(5)6/h10-11,13H,1-9H2,(H,14,15);(H,3,4)(H,5,6) |
| InChIKey | VSFUGXWKTWKOTN-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|