C16H31N3O3 — CID 119834444
N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-2-(oxolan-2-ylmethylamino)acetamide (PubChem CID 119834444) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-2-(oxolan-2-ylmethylamino)acetamide.
| Compound Name | N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-2-(oxolan-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 119834444 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-2-(oxolan-2-ylmethylamino)acetamide |
| SMILES | CC(C)CN1CCOC(CNC(=O)CNCC2CCCO2)C1 |
| InChI | InChI=1S/C16H31N3O3/c1-13(2)11-19-5-7-22-15(12-19)9-18-16(20)10-17-8-14-4-3-6-21-14/h13-15,17H,3-12H2,1-2H3,(H,18,20) |
| InChIKey | DCCFPLBZUDVRRH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |