C20H37N3O2 — CID 55912395
1-(cyclohexylmethyl)-1-cyclopropyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]urea (PubChem CID 55912395) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-1-cyclopropyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]urea.
| Compound Name | 1-(cyclohexylmethyl)-1-cyclopropyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 55912395 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 1-(cyclohexylmethyl)-1-cyclopropyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]urea |
| SMILES | CC(C)CN1CCOC(CNC(=O)N(CC2CCCCC2)C2CC2)C1 |
| InChI | InChI=1S/C20H37N3O2/c1-16(2)13-22-10-11-25-19(15-22)12-21-20(24)23(18-8-9-18)14-17-6-4-3-5-7-17/h16-19H,3-15H2,1-2H3,(H,21,24) |
| InChIKey | VPAXRLUTNIXCSJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |