C11H21ClN2O4 — CID 119726630
methyl 3-[[2-(oxolan-2-ylmethylamino)acetyl]amino]propanoate;hydrochloride (PubChem CID 119726630) has the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. Its IUPAC name is methyl 3-[[2-(oxolan-2-ylmethylamino)acetyl]amino]propanoate;hydrochloride.
| Compound Name | methyl 3-[[2-(oxolan-2-ylmethylamino)acetyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119726630 |
| Molecular Formula | C11H21ClN2O4 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl 3-[[2-(oxolan-2-ylmethylamino)acetyl]amino]propanoate;hydrochloride |
| SMILES | COC(=O)CCNC(=O)CNCC1CCCO1.Cl |
| InChI | InChI=1S/C11H20N2O4.ClH/c1-16-11(15)4-5-13-10(14)8-12-7-9-3-2-6-17-9;/h9,12H,2-8H2,1H3,(H,13,14);1H |
| InChIKey | YGJDUPPKYLXWNE-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |