C17H25N3O4 — CID 54835847
N-(2-methoxyethyl)-4-[[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]amino]benzamide (PubChem CID 54835847) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]amino]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54835847 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]amino]benzamide |
| SMILES | COCCNC(=O)c1ccc(NCC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C17H25N3O4/c1-23-10-8-18-17(22)13-4-6-14(7-5-13)19-12-16(21)20-11-15-3-2-9-24-15/h4-7,15,19H,2-3,8-12H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | MDQOGSZBHDCAGN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|