C9H13Cl2NO2 — CID 86086396
2,2-dichloroethyl N-cyclohex-2-en-1-ylcarbamate (PubChem CID 86086396) has the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. Its IUPAC name is 2,2-dichloroethyl N-cyclohex-2-en-1-ylcarbamate.
| Compound Name | 2,2-dichloroethyl N-cyclohex-2-en-1-ylcarbamate |
|---|---|
| PubChem CID | 86086396 |
| Molecular Formula | C9H13Cl2NO2 |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2,2-dichloroethyl N-cyclohex-2-en-1-ylcarbamate |
| SMILES | O=C(NC1C=CCCC1)OCC(Cl)Cl |
| InChI | InChI=1S/C9H13Cl2NO2/c10-8(11)6-14-9(13)12-7-4-2-1-3-5-7/h2,4,7-8H,1,3,5-6H2,(H,12,13) |
| InChIKey | RUEUFBSYDIBLHM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|