C11H20N2O — CID 106237404
5-(cyclohex-2-en-1-ylamino)pentanamide (PubChem CID 106237404) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-(cyclohex-2-en-1-ylamino)pentanamide.
| Compound Name | 5-(cyclohex-2-en-1-ylamino)pentanamide |
|---|---|
| PubChem CID | 106237404 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 5-(cyclohex-2-en-1-ylamino)pentanamide |
| SMILES | NC(=O)CCCCNC1C=CCCC1 |
| InChI | InChI=1S/C11H20N2O/c12-11(14)8-4-5-9-13-10-6-2-1-3-7-10/h2,6,10,13H,1,3-5,7-9H2,(H2,12,14) |
| InChIKey | UVHNUPADQVUDTO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|