C10H20N2 — CID 103867344
N-cyclohex-2-en-1-yl-N',N'-dimethylethane-1,2-diamine (PubChem CID 103867344) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-cyclohex-2-en-1-yl-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 103867344 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N-cyclohex-2-en-1-yl-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNC1C=CCCC1 |
| InChI | InChI=1S/C10H20N2/c1-12(2)9-8-11-10-6-4-3-5-7-10/h4,6,10-11H,3,5,7-9H2,1-2H3 |
| InChIKey | QYUYNRNPYWQQFQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|