C11H19N — CID 106547294
N-(3-methylbut-2-enyl)cyclohex-2-en-1-amine (PubChem CID 106547294) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)cyclohex-2-en-1-amine.
| Compound Name | N-(3-methylbut-2-enyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 106547294 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-(3-methylbut-2-enyl)cyclohex-2-en-1-amine |
| SMILES | CC(C)=CCNC1C=CCCC1 |
| InChI | InChI=1S/C11H19N/c1-10(2)8-9-12-11-6-4-3-5-7-11/h4,6,8,11-12H,3,5,7,9H2,1-2H3 |
| InChIKey | CTIXZTYOAIUEGY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|