C12H17F2NO — CID 129349301
N-[(1R)-cyclohex-2-en-1-yl]-2-(3,3-difluorocyclobutyl)acetamide (PubChem CID 129349301) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is N-[(1R)-cyclohex-2-en-1-yl]-2-(3,3-difluorocyclobutyl)acetamide.
| Compound Name | N-[(1R)-cyclohex-2-en-1-yl]-2-(3,3-difluorocyclobutyl)acetamide |
|---|---|
| PubChem CID | 129349301 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[(1R)-cyclohex-2-en-1-yl]-2-(3,3-difluorocyclobutyl)acetamide |
| SMILES | O=C(CC1CC(F)(F)C1)N[C@H]1C=CCCC1 |
| InChI | InChI=1S/C12H17F2NO/c13-12(14)7-9(8-12)6-11(16)15-10-4-2-1-3-5-10/h2,4,9-10H,1,3,5-8H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | CVGHFCZTZSVNIK-JTQLQIEISA-N |
| XLogP | 2.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|