C9H17NO2 — CID 107907132
2-(cyclohex-2-en-1-ylamino)propane-1,3-diol (PubChem CID 107907132) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-(cyclohex-2-en-1-ylamino)propane-1,3-diol.
| Compound Name | 2-(cyclohex-2-en-1-ylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 107907132 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2-(cyclohex-2-en-1-ylamino)propane-1,3-diol |
| SMILES | OCC(CO)NC1C=CCCC1 |
| InChI | InChI=1S/C9H17NO2/c11-6-9(7-12)10-8-4-2-1-3-5-8/h2,4,8-12H,1,3,5-7H2 |
| InChIKey | OKFDUMRSVIGWQO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|