C14H14F5N — CID 101429390
(2Z)-N-(2,3,4,5,6-pentafluorophenyl)cyclooct-2-en-1-amine (PubChem CID 101429390) has the molecular formula C14H14F5N and a molecular weight of 291.26 g/mol. Its IUPAC name is (2Z)-N-(2,3,4,5,6-pentafluorophenyl)cyclooct-2-en-1-amine.
| Compound Name | (2Z)-N-(2,3,4,5,6-pentafluorophenyl)cyclooct-2-en-1-amine |
|---|---|
| PubChem CID | 101429390 |
| Molecular Formula | C14H14F5N |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (2Z)-N-(2,3,4,5,6-pentafluorophenyl)cyclooct-2-en-1-amine |
| SMILES | Fc1c(F)c(F)c(NC2/C=C\CCCCC2)c(F)c1F |
| InChI | InChI=1S/C14H14F5N/c15-9-10(16)12(18)14(13(19)11(9)17)20-8-6-4-2-1-3-5-7-8/h4,6,8,20H,1-3,5,7H2/b6-4- |
| InChIKey | PDDHZDKUWBPMSC-XQRVVYSFSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|