C15H28N2 — CID 114227896
(2E)-N-[[1-(dimethylamino)cyclobutyl]methyl]cyclooct-2-en-1-amine (PubChem CID 114227896) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (2E)-N-[[1-(dimethylamino)cyclobutyl]methyl]cyclooct-2-en-1-amine.
| Compound Name | (2E)-N-[[1-(dimethylamino)cyclobutyl]methyl]cyclooct-2-en-1-amine |
|---|---|
| PubChem CID | 114227896 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (2E)-N-[[1-(dimethylamino)cyclobutyl]methyl]cyclooct-2-en-1-amine |
| SMILES | CN(C)C1(CNC2/C=C\CCCCC2)CCC1 |
| InChI | InChI=1S/C15H28N2/c1-17(2)15(11-8-12-15)13-16-14-9-6-4-3-5-7-10-14/h6,9,14,16H,3-5,7-8,10-13H2,1-2H3/b9-6- |
| InChIKey | WTQUOFFFJHTYOM-TWGQIWQCSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|