C12H13ClFN — CID 107908419
2-chloro-N-cyclohex-2-en-1-yl-5-fluoroaniline (PubChem CID 107908419) has the molecular formula C12H13ClFN and a molecular weight of 225.69 g/mol. Its IUPAC name is 2-chloro-N-cyclohex-2-en-1-yl-5-fluoroaniline.
| Compound Name | 2-chloro-N-cyclohex-2-en-1-yl-5-fluoroaniline |
|---|---|
| PubChem CID | 107908419 |
| Molecular Formula | C12H13ClFN |
| Molecular Weight | 225.69 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-chloro-N-cyclohex-2-en-1-yl-5-fluoroaniline |
| SMILES | Fc1ccc(Cl)c(NC2C=CCCC2)c1 |
| InChI | InChI=1S/C12H13ClFN/c13-11-7-6-9(14)8-12(11)15-10-4-2-1-3-5-10/h2,4,6-8,10,15H,1,3,5H2 |
| InChIKey | HBEYMBYEUXURBL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|