C23H36N2O3 — CID 161349347
4-tert-butyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;N-cyclopentyl-2,2-dimethylpropanamide (PubChem CID 161349347) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is 4-tert-butyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;N-cyclopentyl-2,2-dimethylpropanamide.
| Compound Name | 4-tert-butyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;N-cyclopentyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 161349347 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | 4-tert-butyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;N-cyclopentyl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1CCCC1.CC(C)(C)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C13H17NO2.C10H19NO/c1-13(2,3)14-11(15)9-7-4-5-8(6-7)10(9)12(14)16;1-10(2,3)9(12)11-8-6-4-5-7-8/h4-5,7-10H,6H2,1-3H3;8H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | VNSQDBGAJRBIPT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|