C39H63N3O5S — CID 159822761
4-tert-butyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;N-cyclopentyl-2,2-dimethylpropanamide;6-(7,7-dimethyl-5-oxooctyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-2-one (PubChem CID 159822761) has the molecular formula C39H63N3O5S and a molecular weight of 686.02 g/mol. Its IUPAC name is 4-tert-butyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;N-cyclopentyl-2,2-dimethylpropanamide;6-(7,7-dimethyl-5-oxooctyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-2-one.
| Compound Name | 4-tert-butyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;N-cyclopentyl-2,2-dimethylpropanamide;6-(7,7-dimethyl-5-oxooctyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 159822761 |
| Molecular Formula | C39H63N3O5S |
| Molecular Weight | 686.02 g/mol |
| Exact Mass | 685.45 |
| IUPAC Name | 4-tert-butyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione;N-cyclopentyl-2,2-dimethylpropanamide;6-(7,7-dimethyl-5-oxooctyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-2-one |
| SMILES | CC(C)(C)C(=O)NC1CCCC1.CC(C)(C)CC(=O)CCCCC1SCC2CC(=O)NC21.CC(C)(C)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C16H27NO2S.C13H17NO2.C10H19NO/c1-16(2,3)9-12(18)6-4-5-7-13-15-11(10-20-13)8-14(19)17-15;1-13(2,3)14-11(15)9-7-4-5-8(6-7)10(9)12(14)16;1-10(2,3)9(12)11-8-6-4-5-7-8/h11,13,15H,4-10H2,1-3H3,(H,17,19);4-5,7-10H,6H2,1-3H3;8H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | NMLKSPPWDRBYNG-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.02 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|