C21H31N3O6S3 — CID 135193646
(3-methyl-2,5-dioxopyrrolidin-1-yl) 3-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-6-yl)pentanoylamino]ethyldisulfanyl]propanoate (PubChem CID 135193646) has the molecular formula C21H31N3O6S3 and a molecular weight of 517.70 g/mol. Its IUPAC name is (3-methyl-2,5-dioxopyrrolidin-1-yl) 3-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-6-yl)pentanoylamino]ethyldisulfanyl]propanoate.
| Compound Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 3-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-6-yl)pentanoylamino]ethyldisulfanyl]propanoate |
|---|---|
| PubChem CID | 135193646 |
| Molecular Formula | C21H31N3O6S3 |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 3-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-6-yl)pentanoylamino]ethyldisulfanyl]propanoate |
| SMILES | CC1CC(=O)N(OC(=O)CCSSCCNC(=O)CCCCC2SCC3CC(=O)NC32)C1=O |
| InChI | InChI=1S/C21H31N3O6S3/c1-13-10-18(27)24(21(13)29)30-19(28)6-8-32-33-9-7-22-16(25)5-3-2-4-15-20-14(12-31-15)11-17(26)23-20/h13-15,20H,2-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | WSAGONMVLIFQLD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|