C14H19N3O5S2 — CID 88940517
(2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 88940517) has the molecular formula C14H19N3O5S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 88940517 |
| Molecular Formula | C14H19N3O5S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (2,5-dioxo-3-sulfanylpyrrolidin-1-yl) 5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | O=C1N[C@H]2CSC(CCCCC(=O)ON3C(=O)CC(S)C3=O)[C@H]2N1 |
| InChI | InChI=1S/C14H19N3O5S2/c18-10-5-8(23)13(20)17(10)22-11(19)4-2-1-3-9-12-7(6-24-9)15-14(21)16-12/h7-9,12,23H,1-6H2,(H2,15,16,21)/t7-,8?,9?,12-/m0/s1 |
| InChIKey | NBTYVMICWXWRSZ-HBXNBJCXSA-N |
| XLogP | 0.23 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|