C22H38N2O5S — CID 158871380
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-6-yl)-N-[2-[2-(4-oxoheptoxy)ethoxy]ethyl]pentanamide (PubChem CID 158871380) has the molecular formula C22H38N2O5S and a molecular weight of 442.62 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-6-yl)-N-[2-[2-(4-oxoheptoxy)ethoxy]ethyl]pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-6-yl)-N-[2-[2-(4-oxoheptoxy)ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 158871380 |
| Molecular Formula | C22H38N2O5S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-6-yl)-N-[2-[2-(4-oxoheptoxy)ethoxy]ethyl]pentanamide |
| SMILES | CCCC(=O)CCCOCCOCCNC(=O)CCCCC1SCC2CC(=O)NC21 |
| InChI | InChI=1S/C22H38N2O5S/c1-2-6-18(25)7-5-11-28-13-14-29-12-10-23-20(26)9-4-3-8-19-22-17(16-30-19)15-21(27)24-22/h17,19,22H,2-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | QTDZNZVHPYTVPC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|