C16H26N2O2 — CID 90182639
[(3R,5Z)-hepta-1,5-dien-3-yl] N-[(3E)-2-aminocyclooct-3-en-1-yl]carbamate (PubChem CID 90182639) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is [(3R,5Z)-hepta-1,5-dien-3-yl] N-[(3E)-2-aminocyclooct-3-en-1-yl]carbamate.
| Compound Name | [(3R,5Z)-hepta-1,5-dien-3-yl] N-[(3E)-2-aminocyclooct-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 90182639 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | [(3R,5Z)-hepta-1,5-dien-3-yl] N-[(3E)-2-aminocyclooct-3-en-1-yl]carbamate |
| SMILES | C=C[C@@H](C/C=C\C)OC(=O)NC1CCCC/C=C\C1N |
| InChI | InChI=1S/C16H26N2O2/c1-3-5-10-13(4-2)20-16(19)18-15-12-9-7-6-8-11-14(15)17/h3-5,8,11,13-15H,2,6-7,9-10,12,17H2,1H3,(H,18,19)/b5-3-,11-8-/t13-,14?,15?/m0/s1 |
| InChIKey | ASKVWXHJCGCMOH-VWDSVLRGSA-N |
| XLogP | 3.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|