C12H22NO4+ — CID 163453476
[hydroxy-[8-(propanoylamino)cyclooct-2-en-1-yl]oxymethyl]oxidanium (PubChem CID 163453476) has the molecular formula C12H22NO4+ and a molecular weight of 244.31 g/mol. Its IUPAC name is [hydroxy-[8-(propanoylamino)cyclooct-2-en-1-yl]oxymethyl]oxidanium.
| Compound Name | [hydroxy-[8-(propanoylamino)cyclooct-2-en-1-yl]oxymethyl]oxidanium |
|---|---|
| PubChem CID | 163453476 |
| Molecular Formula | C12H22NO4+ |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [hydroxy-[8-(propanoylamino)cyclooct-2-en-1-yl]oxymethyl]oxidanium |
| SMILES | CCC(=O)NC1CCCCC=CC1OC(O)[OH2+] |
| InChI | InChI=1S/C12H21NO4/c1-2-11(14)13-9-7-5-3-4-6-8-10(9)17-12(15)16/h6,8-10,12,15-16H,2-5,7H2,1H3,(H,13,14)/p+1 |
| InChIKey | BILWNLXRFHJDFF-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 81.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|