C10H19NO3 — CID 160683329
butyl N-[(1S,2S)-2-hydroxycyclopentyl]carbamate (PubChem CID 160683329) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is butyl N-[(1S,2S)-2-hydroxycyclopentyl]carbamate.
| Compound Name | butyl N-[(1S,2S)-2-hydroxycyclopentyl]carbamate |
|---|---|
| PubChem CID | 160683329 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | butyl N-[(1S,2S)-2-hydroxycyclopentyl]carbamate |
| SMILES | CCCCOC(=O)N[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C10H19NO3/c1-2-3-7-14-10(13)11-8-5-4-6-9(8)12/h8-9,12H,2-7H2,1H3,(H,11,13)/t8-,9-/m0/s1 |
| InChIKey | ROKZUURIHPVEEK-IUCAKERBSA-N |
| XLogP | 1.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|