C9H14NO3- — CID 9442541
cis-(1R,2S)-2-acetamidocyclohexane-1-carboxylate (PubChem CID 9442541) has the molecular formula C9H14NO3- and a molecular weight of 184.21 g/mol. Its IUPAC name is cis-(1R,2S)-2-acetamidocyclohexane-1-carboxylate.
| Compound Name | cis-(1R,2S)-2-acetamidocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 9442541 |
| Molecular Formula | C9H14NO3- |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | cis-(1R,2S)-2-acetamidocyclohexane-1-carboxylate |
| SMILES | CC(=O)N[C@H]1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C9H15NO3/c1-6(11)10-8-5-3-2-4-7(8)9(12)13/h7-8H,2-5H2,1H3,(H,10,11)(H,12,13)/p-1/t7-,8+/m1/s1 |
| InChIKey | XEWCXCCHQSUMHW-SFYZADRCSA-M |
| XLogP | -0.57 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |