C7H13IN2O — CID 138652029
1-[(1S,2S)-2-iodocyclopentyl]-3-methylurea (PubChem CID 138652029) has the molecular formula C7H13IN2O and a molecular weight of 268.10 g/mol. Its IUPAC name is 1-[(1S,2S)-2-iodocyclopentyl]-3-methylurea.
| Compound Name | 1-[(1S,2S)-2-iodocyclopentyl]-3-methylurea |
|---|---|
| PubChem CID | 138652029 |
| Molecular Formula | C7H13IN2O |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1-[(1S,2S)-2-iodocyclopentyl]-3-methylurea |
| SMILES | CNC(=O)N[C@H]1CCC[C@@H]1I |
| InChI | InChI=1S/C7H13IN2O/c1-9-7(11)10-6-4-2-3-5(6)8/h5-6H,2-4H2,1H3,(H2,9,10,11)/t5-,6-/m0/s1 |
| InChIKey | PYIAGNMNOXZDLI-WDSKDSINSA-N |
| XLogP | 1.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|