C9H18N4O2 — CID 138569359
1-ethyl-3-[[2-(methylcarbamoylamino)cyclopropyl]methyl]urea (PubChem CID 138569359) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(methylcarbamoylamino)cyclopropyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[2-(methylcarbamoylamino)cyclopropyl]methyl]urea |
|---|---|
| PubChem CID | 138569359 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-ethyl-3-[[2-(methylcarbamoylamino)cyclopropyl]methyl]urea |
| SMILES | CCNC(=O)NCC1CC1NC(=O)NC |
| InChI | InChI=1S/C9H18N4O2/c1-3-11-9(15)12-5-6-4-7(6)13-8(14)10-2/h6-7H,3-5H2,1-2H3,(H2,10,13,14)(H2,11,12,15) |
| InChIKey | NVVWSHXLZQMUNE-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |