C8H16N2O — CID 130628740
1-methyl-3-[(1R,2R)-2-propylcyclopropyl]urea (PubChem CID 130628740) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-methyl-3-[(1R,2R)-2-propylcyclopropyl]urea.
| Compound Name | 1-methyl-3-[(1R,2R)-2-propylcyclopropyl]urea |
|---|---|
| PubChem CID | 130628740 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-methyl-3-[(1R,2R)-2-propylcyclopropyl]urea |
| SMILES | CCC[C@@H]1C[C@H]1NC(=O)NC |
| InChI | InChI=1S/C8H16N2O/c1-3-4-6-5-7(6)10-8(11)9-2/h6-7H,3-5H2,1-2H3,(H2,9,10,11)/t6-,7-/m1/s1 |
| InChIKey | BZSVQWCCGIENMD-RNFRBKRXSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |