C11H22N2O — CID 115626414
1-(2,4-dimethylcyclohexyl)-3-ethylurea (PubChem CID 115626414) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(2,4-dimethylcyclohexyl)-3-ethylurea.
| Compound Name | 1-(2,4-dimethylcyclohexyl)-3-ethylurea |
|---|---|
| PubChem CID | 115626414 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(2,4-dimethylcyclohexyl)-3-ethylurea |
| SMILES | CCNC(=O)NC1CCC(C)CC1C |
| InChI | InChI=1S/C11H22N2O/c1-4-12-11(14)13-10-6-5-8(2)7-9(10)3/h8-10H,4-7H2,1-3H3,(H2,12,13,14) |
| InChIKey | LMBDIAXGCKMDIN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |