C13H24N2O4 — CID 107827924
(2R)-2-[(2,4-dimethylcyclohexyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107827924) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2R)-2-[(2,4-dimethylcyclohexyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[(2,4-dimethylcyclohexyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107827924 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (2R)-2-[(2,4-dimethylcyclohexyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | CC1CCC(NC(=O)N[C@H](CCO)C(=O)O)C(C)C1 |
| InChI | InChI=1S/C13H24N2O4/c1-8-3-4-10(9(2)7-8)14-13(19)15-11(5-6-16)12(17)18/h8-11,16H,3-7H2,1-2H3,(H,17,18)(H2,14,15,19)/t8?,9?,10?,11-/m1/s1 |
| InChIKey | YEFVATRLIDDOJV-AHELAYONSA-N |
| XLogP | 0.95 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |