C14H24N2O5 — CID 63999990
2-[(2,4-dimethylcyclohexyl)carbamoylamino]pentanedioic acid (PubChem CID 63999990) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[(2,4-dimethylcyclohexyl)carbamoylamino]pentanedioic acid.
| Compound Name | 2-[(2,4-dimethylcyclohexyl)carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 63999990 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[(2,4-dimethylcyclohexyl)carbamoylamino]pentanedioic acid |
| SMILES | CC1CCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(C)C1 |
| InChI | InChI=1S/C14H24N2O5/c1-8-3-4-10(9(2)7-8)15-14(21)16-11(13(19)20)5-6-12(17)18/h8-11H,3-7H2,1-2H3,(H,17,18)(H,19,20)(H2,15,16,21) |
| InChIKey | HYRNERVHPBCNSM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |