C7H15N3O2 — CID 144606750
1-[(1S,2R)-4-amino-2-hydroxycyclopentyl]-3-methylurea (PubChem CID 144606750) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 1-[(1S,2R)-4-amino-2-hydroxycyclopentyl]-3-methylurea.
| Compound Name | 1-[(1S,2R)-4-amino-2-hydroxycyclopentyl]-3-methylurea |
|---|---|
| PubChem CID | 144606750 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-[(1S,2R)-4-amino-2-hydroxycyclopentyl]-3-methylurea |
| SMILES | CNC(=O)N[C@H]1CC(N)C[C@H]1O |
| InChI | InChI=1S/C7H15N3O2/c1-9-7(12)10-5-2-4(8)3-6(5)11/h4-6,11H,2-3,8H2,1H3,(H2,9,10,12)/t4?,5-,6+/m0/s1 |
| InChIKey | JMDURLUYACMMKJ-DUAGOPDLSA-N |
| XLogP | -1.23 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |