C11H19NOS — CID 103683381
(E)-N-(2-methylsulfanylcyclohexyl)but-2-enamide (PubChem CID 103683381) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is (E)-N-(2-methylsulfanylcyclohexyl)but-2-enamide.
| Compound Name | (E)-N-(2-methylsulfanylcyclohexyl)but-2-enamide |
|---|---|
| PubChem CID | 103683381 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (E)-N-(2-methylsulfanylcyclohexyl)but-2-enamide |
| SMILES | C/C=C/C(=O)NC1CCCCC1SC |
| InChI | InChI=1S/C11H19NOS/c1-3-6-11(13)12-9-7-4-5-8-10(9)14-2/h3,6,9-10H,4-5,7-8H2,1-2H3,(H,12,13)/b6-3+ |
| InChIKey | XQYMXWOAGBUGHN-ZZXKWVIFSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|