C13H26N2O2S — CID 75379203
1-(2-hydroxy-2-methylpropyl)-1-methyl-3-(2-methylsulfanylcyclohexyl)urea (PubChem CID 75379203) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-(2-hydroxy-2-methylpropyl)-1-methyl-3-(2-methylsulfanylcyclohexyl)urea.
| Compound Name | 1-(2-hydroxy-2-methylpropyl)-1-methyl-3-(2-methylsulfanylcyclohexyl)urea |
|---|---|
| PubChem CID | 75379203 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(2-hydroxy-2-methylpropyl)-1-methyl-3-(2-methylsulfanylcyclohexyl)urea |
| SMILES | CSC1CCCCC1NC(=O)N(C)CC(C)(C)O |
| InChI | InChI=1S/C13H26N2O2S/c1-13(2,17)9-15(3)12(16)14-10-7-5-6-8-11(10)18-4/h10-11,17H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | SIUMZVMSMDADGH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |