C14H19NOS2 — CID 114124428
N-(2-methylsulfanylcyclohexyl)-4-sulfanylbenzamide (PubChem CID 114124428) has the molecular formula C14H19NOS2 and a molecular weight of 281.45 g/mol. Its IUPAC name is N-(2-methylsulfanylcyclohexyl)-4-sulfanylbenzamide.
| Compound Name | N-(2-methylsulfanylcyclohexyl)-4-sulfanylbenzamide |
|---|---|
| PubChem CID | 114124428 |
| Molecular Formula | C14H19NOS2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-(2-methylsulfanylcyclohexyl)-4-sulfanylbenzamide |
| SMILES | CSC1CCCCC1NC(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C14H19NOS2/c1-18-13-5-3-2-4-12(13)15-14(16)10-6-8-11(17)9-7-10/h6-9,12-13,17H,2-5H2,1H3,(H,15,16) |
| InChIKey | WZRRUHSXLANEEN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|