About 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide
4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide (PubChem CID 97215389) has the molecular formula C16H23NO2S
and a molecular weight of 293.43 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide |
| PubChem CID | 97215389 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide |
| SMILES | COCc1ccc(C(=O)N[C@H]2CCCC[C@@H]2SC)cc1 |
| InChI | InChI=1S/C16H23NO2S/c1-19-11-12-7-9-13(10-8-12)16(18)17-14-5-3-4-6-15(14)20-2/h7-10,14-15H,3-6,11H2,1-2H3,(H,17,18)/t14-,15-/m0/s1 |
| InChIKey | DGKIGCIFBGTWOC-GJZGRUSLSA-N |
| XLogP | 3.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide?
The IUPAC name of 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide (CID 97215389) is 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide.
What is the SMILES notation for 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide?
The canonical SMILES for 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide is COCc1ccc(C(=O)N[C@H]2CCCC[C@@H]2SC)cc1.
What is the InChIKey of 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide?
The InChIKey is DGKIGCIFBGTWOC-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H23NO2S/c1-19-11-12-7-9-13(10-8-12)16(18)17-14-5-3-4-6-15(14)20-2/h7-10,14-15H,3-6,11H2,1-2H3,(H,17,18)/t14-,15-/m0/s1.
What are the key properties of 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide?
4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide has a molecular weight of 293.43 g/mol, XLogP of 3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-N-[(1S,2S)-2-methylsulfanylcyclohexyl]benzamide is sourced from PubChem (CID 97215389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).