C13H16INO2S — CID 104628956
3-hydroxy-4-iodo-N-(2-methylsulfanylcyclopentyl)benzamide (PubChem CID 104628956) has the molecular formula C13H16INO2S and a molecular weight of 377.25 g/mol. Its IUPAC name is 3-hydroxy-4-iodo-N-(2-methylsulfanylcyclopentyl)benzamide.
| Compound Name | 3-hydroxy-4-iodo-N-(2-methylsulfanylcyclopentyl)benzamide |
|---|---|
| PubChem CID | 104628956 |
| Molecular Formula | C13H16INO2S |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 3-hydroxy-4-iodo-N-(2-methylsulfanylcyclopentyl)benzamide |
| SMILES | CSC1CCCC1NC(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C13H16INO2S/c1-18-12-4-2-3-10(12)15-13(17)8-5-6-9(14)11(16)7-8/h5-7,10,12,16H,2-4H2,1H3,(H,15,17) |
| InChIKey | BIYCRTYAKAJXBF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|