C13H14INO3 — CID 113434890
3-hydroxy-4-iodo-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide (PubChem CID 113434890) has the molecular formula C13H14INO3 and a molecular weight of 359.16 g/mol. Its IUPAC name is 3-hydroxy-4-iodo-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide.
| Compound Name | 3-hydroxy-4-iodo-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide |
|---|---|
| PubChem CID | 113434890 |
| Molecular Formula | C13H14INO3 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 3-hydroxy-4-iodo-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide |
| SMILES | O=C(NC1CC2CCC1O2)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C13H14INO3/c14-9-3-1-7(5-11(9)16)13(17)15-10-6-8-2-4-12(10)18-8/h1,3,5,8,10,12,16H,2,4,6H2,(H,15,17) |
| InChIKey | ARGKAUDBNONUFV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|