C14H14N2O3S — CID 99833542
N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 99833542) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 99833542 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]2CC[C@H]1O2)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C14H14N2O3S/c17-13(15-10-6-8-2-4-11(10)18-8)7-1-3-9-12(5-7)19-14(20)16-9/h1,3,5,8,10-11H,2,4,6H2,(H,15,17)(H,16,20)/t8-,10+,11-/m1/s1 |
| InChIKey | ADYQTFPUZLSSOG-DVVUODLYSA-N |
| XLogP | 2.54 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|