C16H17N3O3S — CID 99833535
3-methyl-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 99833535) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-methyl-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-methyl-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 99833535 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-methyl-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | Cn1c(=S)[nH]c2cc(C(=O)N[C@H]3C[C@H]4CC[C@H]3O4)ccc2c1=O |
| InChI | InChI=1S/C16H17N3O3S/c1-19-15(21)10-4-2-8(6-11(10)18-16(19)23)14(20)17-12-7-9-3-5-13(12)22-9/h2,4,6,9,12-13H,3,5,7H2,1H3,(H,17,20)(H,18,23)/t9-,12+,13-/m1/s1 |
| InChIKey | DIBYVHGRGYEGLC-JIMOISOXSA-N |
| XLogP | 1.65 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|